C19H25NO4S — CID 90593882
1-(3-cyclohexylsulfonylazetidin-1-yl)-4-phenylbutane-1,4-dione (PubChem CID 90593882) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-(3-cyclohexylsulfonylazetidin-1-yl)-4-phenylbutane-1,4-dione.
| Compound Name | 1-(3-cyclohexylsulfonylazetidin-1-yl)-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 90593882 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-(3-cyclohexylsulfonylazetidin-1-yl)-4-phenylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CC(S(=O)(=O)C2CCCCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO4S/c21-18(15-7-3-1-4-8-15)11-12-19(22)20-13-17(14-20)25(23,24)16-9-5-2-6-10-16/h1,3-4,7-8,16-17H,2,5-6,9-14H2 |
| InChIKey | AVNIVJJARVUWGX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |