C16H20ClNO3S — CID 71809328
(2-chlorophenyl)-(3-cyclohexylsulfonylazetidin-1-yl)methanone (PubChem CID 71809328) has the molecular formula C16H20ClNO3S and a molecular weight of 341.86 g/mol. Its IUPAC name is (2-chlorophenyl)-(3-cyclohexylsulfonylazetidin-1-yl)methanone.
| Compound Name | (2-chlorophenyl)-(3-cyclohexylsulfonylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 71809328 |
| Molecular Formula | C16H20ClNO3S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (2-chlorophenyl)-(3-cyclohexylsulfonylazetidin-1-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1CC(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C16H20ClNO3S/c17-15-9-5-4-8-14(15)16(19)18-10-13(11-18)22(20,21)12-6-2-1-3-7-12/h4-5,8-9,12-13H,1-3,6-7,10-11H2 |
| InChIKey | QOMVEVYXLCJKSR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |