C17H22ClNO3S — CID 90593744
2-(4-chlorophenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)ethanone (PubChem CID 90593744) has the molecular formula C17H22ClNO3S and a molecular weight of 355.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 90593744 |
| Molecular Formula | C17H22ClNO3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CC(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C17H22ClNO3S/c18-14-8-6-13(7-9-14)10-17(20)19-11-16(12-19)23(21,22)15-4-2-1-3-5-15/h6-9,15-16H,1-5,10-12H2 |
| InChIKey | YIQXYZWFHVTZOE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |