C17H23ClN2O5S2 — CID 71809313
3-chloro-N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]benzenesulfonamide (PubChem CID 71809313) has the molecular formula C17H23ClN2O5S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 3-chloro-N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71809313 |
| Molecular Formula | C17H23ClN2O5S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 3-chloro-N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]benzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1cccc(Cl)c1)N1CC(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C17H23ClN2O5S2/c18-13-5-4-8-15(9-13)27(24,25)19-10-17(21)20-11-16(12-20)26(22,23)14-6-2-1-3-7-14/h4-5,8-9,14,16,19H,1-3,6-7,10-12H2 |
| InChIKey | GNUXZONIFFYMMK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |