C11H14N2O4S — CID 63106764
N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]benzenesulfonamide (PubChem CID 63106764) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63106764 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]benzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)N1CC(O)C1 |
| InChI | InChI=1S/C11H14N2O4S/c14-9-7-13(8-9)11(15)6-12-18(16,17)10-4-2-1-3-5-10/h1-5,9,12,14H,6-8H2 |
| InChIKey | PYGRNKORIHNDIQ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |