C19H22N2O5S2 — CID 90586620
N-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzenesulfonamide (PubChem CID 90586620) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90586620 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCC(=O)N2CCC(S(=O)(=O)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-15-6-5-9-17(12-15)28(25,26)20-13-19(22)21-11-10-18(14-21)27(23,24)16-7-3-2-4-8-16/h2-9,12,18,20H,10-11,13-14H2,1H3 |
| InChIKey | DTJOYBWIQWFEKE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |