C17H25N3O6S2 — CID 90592591
N-methyl-2-[1-[2-[(3-methylphenyl)sulfonylamino]acetyl]piperidin-4-yl]sulfonylacetamide (PubChem CID 90592591) has the molecular formula C17H25N3O6S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-methyl-2-[1-[2-[(3-methylphenyl)sulfonylamino]acetyl]piperidin-4-yl]sulfonylacetamide.
| Compound Name | N-methyl-2-[1-[2-[(3-methylphenyl)sulfonylamino]acetyl]piperidin-4-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 90592591 |
| Molecular Formula | C17H25N3O6S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-methyl-2-[1-[2-[(3-methylphenyl)sulfonylamino]acetyl]piperidin-4-yl]sulfonylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(C(=O)CNS(=O)(=O)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C17H25N3O6S2/c1-13-4-3-5-15(10-13)28(25,26)19-11-17(22)20-8-6-14(7-9-20)27(23,24)12-16(21)18-2/h3-5,10,14,19H,6-9,11-12H2,1-2H3,(H,18,21) |
| InChIKey | FTEHSQBQESZCGZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |