C15H20ClNO4S2 — CID 90594008
1-(3-chlorophenyl)sulfonyl-3-cyclohexylsulfonylazetidine (PubChem CID 90594008) has the molecular formula C15H20ClNO4S2 and a molecular weight of 377.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3-cyclohexylsulfonylazetidine.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3-cyclohexylsulfonylazetidine |
|---|---|
| PubChem CID | 90594008 |
| Molecular Formula | C15H20ClNO4S2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3-cyclohexylsulfonylazetidine |
| SMILES | O=S(=O)(C1CCCCC1)C1CN(S(=O)(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H20ClNO4S2/c16-12-5-4-8-14(9-12)23(20,21)17-10-15(11-17)22(18,19)13-6-2-1-3-7-13/h4-5,8-9,13,15H,1-3,6-7,10-11H2 |
| InChIKey | WRCPUFXOWGWRKG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |