C15H20BrNO4S2 — CID 90594041
1-(2-bromophenyl)sulfonyl-3-cyclohexylsulfonylazetidine (PubChem CID 90594041) has the molecular formula C15H20BrNO4S2 and a molecular weight of 422.37 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-3-cyclohexylsulfonylazetidine.
| Compound Name | 1-(2-bromophenyl)sulfonyl-3-cyclohexylsulfonylazetidine |
|---|---|
| PubChem CID | 90594041 |
| Molecular Formula | C15H20BrNO4S2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-3-cyclohexylsulfonylazetidine |
| SMILES | O=S(=O)(C1CCCCC1)C1CN(S(=O)(=O)c2ccccc2Br)C1 |
| InChI | InChI=1S/C15H20BrNO4S2/c16-14-8-4-5-9-15(14)23(20,21)17-10-13(11-17)22(18,19)12-6-2-1-3-7-12/h4-5,8-9,12-13H,1-3,6-7,10-11H2 |
| InChIKey | WTHBJWPRQZFWTA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |