C18H27NO5S2 — CID 90594028
3-cyclohexylsulfonyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylazetidine (PubChem CID 90594028) has the molecular formula C18H27NO5S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 3-cyclohexylsulfonyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylazetidine.
| Compound Name | 3-cyclohexylsulfonyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90594028 |
| Molecular Formula | C18H27NO5S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-cyclohexylsulfonyl-1-(2-methoxy-4,5-dimethylphenyl)sulfonylazetidine |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)N1CC(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C18H27NO5S2/c1-13-9-17(24-3)18(10-14(13)2)26(22,23)19-11-16(12-19)25(20,21)15-7-5-4-6-8-15/h9-10,15-16H,4-8,11-12H2,1-3H3 |
| InChIKey | KDRCQQVBLIEFQI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |