C13H18BrNO4S3 — CID 90594043
1-(5-bromothiophen-2-yl)sulfonyl-3-cyclohexylsulfonylazetidine (PubChem CID 90594043) has the molecular formula C13H18BrNO4S3 and a molecular weight of 428.40 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-3-cyclohexylsulfonylazetidine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-3-cyclohexylsulfonylazetidine |
|---|---|
| PubChem CID | 90594043 |
| Molecular Formula | C13H18BrNO4S3 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-3-cyclohexylsulfonylazetidine |
| SMILES | O=S(=O)(C1CCCCC1)C1CN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C13H18BrNO4S3/c14-12-6-7-13(20-12)22(18,19)15-8-11(9-15)21(16,17)10-4-2-1-3-5-10/h6-7,10-11H,1-5,8-9H2 |
| InChIKey | RJPMUBFLXIVOOC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |