C11H16BrNO3S2 — CID 54990170
1-(5-bromothiophen-2-yl)sulfonyl-3-ethoxypiperidine (PubChem CID 54990170) has the molecular formula C11H16BrNO3S2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-3-ethoxypiperidine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-3-ethoxypiperidine |
|---|---|
| PubChem CID | 54990170 |
| Molecular Formula | C11H16BrNO3S2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-3-ethoxypiperidine |
| SMILES | CCOC1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C11H16BrNO3S2/c1-2-16-9-4-3-7-13(8-9)18(14,15)11-6-5-10(12)17-11/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | TYORGRPKEJOJJZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |