C13H19BrN2O2S2 — CID 81200124
6-(5-bromothiophen-2-yl)sulfonyl-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 81200124) has the molecular formula C13H19BrN2O2S2 and a molecular weight of 379.35 g/mol. Its IUPAC name is 6-(5-bromothiophen-2-yl)sulfonyl-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | 6-(5-bromothiophen-2-yl)sulfonyl-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 81200124 |
| Molecular Formula | C13H19BrN2O2S2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 6-(5-bromothiophen-2-yl)sulfonyl-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CN1CCCC2CN(S(=O)(=O)c3ccc(Br)s3)CCC21 |
| InChI | InChI=1S/C13H19BrN2O2S2/c1-15-7-2-3-10-9-16(8-6-11(10)15)20(17,18)13-5-4-12(14)19-13/h4-5,10-11H,2-3,6-9H2,1H3 |
| InChIKey | GPQIDCKGAMRXFY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |