C11H16BrNO2S2 — CID 115872296
1-(5-bromothiophen-2-yl)sulfonyl-3,4-dimethylpiperidine (PubChem CID 115872296) has the molecular formula C11H16BrNO2S2 and a molecular weight of 338.29 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-3,4-dimethylpiperidine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-3,4-dimethylpiperidine |
|---|---|
| PubChem CID | 115872296 |
| Molecular Formula | C11H16BrNO2S2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-3,4-dimethylpiperidine |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(Br)s2)CC1C |
| InChI | InChI=1S/C11H16BrNO2S2/c1-8-5-6-13(7-9(8)2)17(14,15)11-4-3-10(12)16-11/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | CJTLTNIAIZYGJW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |