C11H17BrN2O2S2 — CID 120778998
1-(5-bromothiophen-2-yl)sulfonyl-3,3-dimethylpiperidin-4-amine (PubChem CID 120778998) has the molecular formula C11H17BrN2O2S2 and a molecular weight of 353.31 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120778998 |
| Molecular Formula | C11H17BrN2O2S2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-3,3-dimethylpiperidin-4-amine |
| SMILES | CC1(C)CN(S(=O)(=O)c2ccc(Br)s2)CCC1N |
| InChI | InChI=1S/C11H17BrN2O2S2/c1-11(2)7-14(6-5-8(11)13)18(15,16)10-4-3-9(12)17-10/h3-4,8H,5-7,13H2,1-2H3 |
| InChIKey | GWZJXDSBWSMVML-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |