C15H22BrN3O4S2 — CID 24642184
1-(5-bromothiophen-2-yl)sulfonyl-N-[2-oxo-2-(propylamino)ethyl]piperidine-3-carboxamide (PubChem CID 24642184) has the molecular formula C15H22BrN3O4S2 and a molecular weight of 452.40 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-[2-oxo-2-(propylamino)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-[2-oxo-2-(propylamino)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24642184 |
| Molecular Formula | C15H22BrN3O4S2 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-[2-oxo-2-(propylamino)ethyl]piperidine-3-carboxamide |
| SMILES | CCCNC(=O)CNC(=O)C1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C15H22BrN3O4S2/c1-2-7-17-13(20)9-18-15(21)11-4-3-8-19(10-11)25(22,23)14-6-5-12(16)24-14/h5-6,11H,2-4,7-10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | PAVAHDDGMVENDU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |