C19H29BrN2O4S2 — CID 24654803
1-(5-bromothiophen-2-yl)sulfonyl-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide (PubChem CID 24654803) has the molecular formula C19H29BrN2O4S2 and a molecular weight of 493.49 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24654803 |
| Molecular Formula | C19H29BrN2O4S2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)C1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C19H29BrN2O4S2/c20-17-9-10-18(27-17)28(24,25)22-12-4-6-15(14-22)19(23)21-11-5-13-26-16-7-2-1-3-8-16/h9-10,15-16H,1-8,11-14H2,(H,21,23) |
| InChIKey | CDDBKKRPOPCDNQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|