C12H17BrN2O4S2 — CID 78838767
1-(5-bromothiophen-2-yl)sulfonyl-N-(2-hydroxyethyl)piperidine-3-carboxamide (PubChem CID 78838767) has the molecular formula C12H17BrN2O4S2 and a molecular weight of 397.32 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-hydroxyethyl)piperidine-3-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-hydroxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 78838767 |
| Molecular Formula | C12H17BrN2O4S2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-hydroxyethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCO)C1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C12H17BrN2O4S2/c13-10-3-4-11(20-10)21(18,19)15-6-1-2-9(8-15)12(17)14-5-7-16/h3-4,9,16H,1-2,5-8H2,(H,14,17) |
| InChIKey | CFHOYWOYGNWYTH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |