C20H25BrN2O3S2 — CID 24630317
1-(5-bromothiophen-2-yl)sulfonyl-N-(2-tert-butylphenyl)piperidine-3-carboxamide (PubChem CID 24630317) has the molecular formula C20H25BrN2O3S2 and a molecular weight of 485.47 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-tert-butylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-tert-butylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24630317 |
| Molecular Formula | C20H25BrN2O3S2 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-tert-butylphenyl)piperidine-3-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C20H25BrN2O3S2/c1-20(2,3)15-8-4-5-9-16(15)22-19(24)14-7-6-12-23(13-14)28(25,26)18-11-10-17(21)27-18/h4-5,8-11,14H,6-7,12-13H2,1-3H3,(H,22,24) |
| InChIKey | LJROTSDALRMPMA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |