C14H17BrN4O3S2 — CID 60519424
1-(5-bromothiophen-2-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)piperidine-3-carboxamide (PubChem CID 60519424) has the molecular formula C14H17BrN4O3S2 and a molecular weight of 433.35 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 60519424 |
| Molecular Formula | C14H17BrN4O3S2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCCN(S(=O)(=O)c3ccc(Br)s3)C2)n[nH]1 |
| InChI | InChI=1S/C14H17BrN4O3S2/c1-9-7-12(18-17-9)16-14(20)10-3-2-6-19(8-10)24(21,22)13-5-4-11(15)23-13/h4-5,7,10H,2-3,6,8H2,1H3,(H2,16,17,18,20) |
| InChIKey | IYHBNMLHXWIVEO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |