C14H17BrN4O3S2 — CID 32622470
(3R)-1-(5-bromothiophen-2-yl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide (PubChem CID 32622470) has the molecular formula C14H17BrN4O3S2 and a molecular weight of 433.35 g/mol. Its IUPAC name is (3R)-1-(5-bromothiophen-2-yl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(5-bromothiophen-2-yl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 32622470 |
| Molecular Formula | C14H17BrN4O3S2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | (3R)-1-(5-bromothiophen-2-yl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide |
| SMILES | Cn1ccc(NC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc(Br)s3)C2)n1 |
| InChI | InChI=1S/C14H17BrN4O3S2/c1-18-8-6-12(17-18)16-14(20)10-3-2-7-19(9-10)24(21,22)13-5-4-11(15)23-13/h4-6,8,10H,2-3,7,9H2,1H3,(H,16,17,20)/t10-/m1/s1 |
| InChIKey | YEZIQMJUTVQIGC-SNVBAGLBSA-N |
| XLogP | 2.28 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |