C16H19FN4O3S — CID 51238050
1-(4-fluorophenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide (PubChem CID 51238050) has the molecular formula C16H19FN4O3S and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51238050 |
| Molecular Formula | C16H19FN4O3S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide |
| SMILES | Cn1ccc(NC(=O)C2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C16H19FN4O3S/c1-20-10-8-15(19-20)18-16(22)12-3-2-9-21(11-12)25(23,24)14-6-4-13(17)5-7-14/h4-8,10,12H,2-3,9,11H2,1H3,(H,18,19,22) |
| InChIKey | VCQLRGHZBZUCSC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |