C17H22N4O4S — CID 18092782
1-(4-methoxyphenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide (PubChem CID 18092782) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 18092782 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-N-(1-methylpyrazol-3-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)Nc3ccn(C)n3)C2)cc1 |
| InChI | InChI=1S/C17H22N4O4S/c1-20-11-9-16(19-20)18-17(22)13-4-3-10-21(12-13)26(23,24)15-7-5-14(25-2)6-8-15/h5-9,11,13H,3-4,10,12H2,1-2H3,(H,18,19,22) |
| InChIKey | IMHKLPNXQVKNSH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |