C17H18N4O3S3 — CID 55976325
N-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 55976325) has the molecular formula C17H18N4O3S3 and a molecular weight of 422.56 g/mol. Its IUPAC name is N-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55976325 |
| Molecular Formula | C17H18N4O3S3 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-(5-thiophen-2-yl-1H-pyrazol-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1cc(-c2cccs2)[nH]n1)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H18N4O3S3/c22-17(18-15-10-13(19-20-15)14-5-2-8-25-14)12-4-1-7-21(11-12)27(23,24)16-6-3-9-26-16/h2-3,5-6,8-10,12H,1,4,7,11H2,(H2,18,19,20,22) |
| InChIKey | NEXDCJNDEMGKDN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |