C17H18N4O3S2 — CID 134037452
N-(1H-indazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 134037452) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(1H-indazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 134037452 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-(1H-indazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H18N4O3S2/c22-17(19-14-5-6-15-13(9-14)10-18-20-15)12-3-1-7-21(11-12)26(23,24)16-4-2-8-25-16/h2,4-6,8-10,12H,1,3,7,11H2,(H,18,20)(H,19,22) |
| InChIKey | QECZWYPGJYZBKM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |