C16H24N2O3S2 — CID 7012508
(3R)-N-cyclohexyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 7012508) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclohexyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 7012508 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (3R)-N-cyclohexyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H24N2O3S2/c19-16(17-14-7-2-1-3-8-14)13-6-4-10-18(12-13)23(20,21)15-9-5-11-22-15/h5,9,11,13-14H,1-4,6-8,10,12H2,(H,17,19)/t13-/m1/s1 |
| InChIKey | WRFBSLYECTVFRP-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |