C21H28N4O3S2 — CID 55857840
N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 55857840) has the molecular formula C21H28N4O3S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55857840 |
| Molecular Formula | C21H28N4O3S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccn2)CC1)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C21H28N4O3S2/c26-21(17-5-3-11-25(15-17)30(27,28)20-7-4-14-29-20)23-18-8-12-24(13-9-18)16-19-6-1-2-10-22-19/h1-2,4,6-7,10,14,17-18H,3,5,8-9,11-13,15-16H2,(H,23,26) |
| InChIKey | QRNBBCNGGZWYNK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |