C15H20N4O5S2 — CID 46628290
N-cyclopropyl-2-oxo-2-[2-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)hydrazinyl]acetamide (PubChem CID 46628290) has the molecular formula C15H20N4O5S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-cyclopropyl-2-oxo-2-[2-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)hydrazinyl]acetamide.
| Compound Name | N-cyclopropyl-2-oxo-2-[2-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)hydrazinyl]acetamide |
|---|---|
| PubChem CID | 46628290 |
| Molecular Formula | C15H20N4O5S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-cyclopropyl-2-oxo-2-[2-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)hydrazinyl]acetamide |
| SMILES | O=C(NNC(=O)C1CCCN(S(=O)(=O)c2cccs2)C1)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H20N4O5S2/c20-13(17-18-15(22)14(21)16-11-5-6-11)10-3-1-7-19(9-10)26(23,24)12-4-2-8-25-12/h2,4,8,10-11H,1,3,5-7,9H2,(H,16,21)(H,17,20)(H,18,22) |
| InChIKey | HEHUSSJZRPKHOD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|