C17H18FN3O4S2 — CID 9084777
(3R)-N'-(2-fluorobenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide (PubChem CID 9084777) has the molecular formula C17H18FN3O4S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is (3R)-N'-(2-fluorobenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide.
| Compound Name | (3R)-N'-(2-fluorobenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 9084777 |
| Molecular Formula | C17H18FN3O4S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (3R)-N'-(2-fluorobenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1)c1ccccc1F |
| InChI | InChI=1S/C17H18FN3O4S2/c18-14-7-2-1-6-13(14)17(23)20-19-16(22)12-5-3-9-21(11-12)27(24,25)15-8-4-10-26-15/h1-2,4,6-8,10,12H,3,5,9,11H2,(H,19,22)(H,20,23)/t12-/m1/s1 |
| InChIKey | TUIAZXKTLDRBCF-GFCCVEGCSA-N |
| XLogP | 1.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|