C18H21N3O4S2 — CID 9086805
(3R)-N'-(4-methylbenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide (PubChem CID 9086805) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (3R)-N'-(4-methylbenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide.
| Compound Name | (3R)-N'-(4-methylbenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 9086805 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (3R)-N'-(4-methylbenzoyl)-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)[C@@H]2CCCN(S(=O)(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-13-6-8-14(9-7-13)17(22)19-20-18(23)15-4-2-10-21(12-15)27(24,25)16-5-3-11-26-16/h3,5-9,11,15H,2,4,10,12H2,1H3,(H,19,22)(H,20,23)/t15-/m1/s1 |
| InChIKey | RCSLCYOCKTVPOF-OAHLLOKOSA-N |
| XLogP | 1.92 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|