C17H20BrN3O3S2 — CID 30376778
(3S)-1-(5-bromothiophen-2-yl)sulfonyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide (PubChem CID 30376778) has the molecular formula C17H20BrN3O3S2 and a molecular weight of 458.40 g/mol. Its IUPAC name is (3S)-1-(5-bromothiophen-2-yl)sulfonyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(5-bromothiophen-2-yl)sulfonyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 30376778 |
| Molecular Formula | C17H20BrN3O3S2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | (3S)-1-(5-bromothiophen-2-yl)sulfonyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCc1ccccn1)[C@H]1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C17H20BrN3O3S2/c18-15-6-7-16(25-15)26(23,24)21-11-3-4-13(12-21)17(22)20-10-8-14-5-1-2-9-19-14/h1-2,5-7,9,13H,3-4,8,10-12H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | PNMVIVMKDNSBJJ-ZDUSSCGKSA-N |
| XLogP | 2.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |