C19H28IN5O2S2 — CID 111191465
2-methyl-1-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111191465) has the molecular formula C19H28IN5O2S2 and a molecular weight of 549.50 g/mol. Its IUPAC name is 2-methyl-1-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111191465 |
| Molecular Formula | C19H28IN5O2S2 |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 2-methyl-1-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1ccc(S(=O)(=O)N2CCCCC2)s1.I |
| InChI | InChI=1S/C19H27N5O2S2.HI/c1-20-19(22-12-10-16-7-3-4-11-21-16)23-15-17-8-9-18(27-17)28(25,26)24-13-5-2-6-14-24;/h3-4,7-9,11H,2,5-6,10,12-15H2,1H3,(H2,20,22,23);1H |
| InChIKey | BEQZQIDBNHDEON-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|