C17H30N4O3S2 — CID 111606295
1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine (PubChem CID 111606295) has the molecular formula C17H30N4O3S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111606295 |
| Molecular Formula | C17H30N4O3S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCCC2)s1)NCC(C)(C)OC |
| InChI | InChI=1S/C17H30N4O3S2/c1-17(2,24-4)13-20-16(18-3)19-12-14-8-9-15(25-14)26(22,23)21-10-6-5-7-11-21/h8-9H,5-7,10-13H2,1-4H3,(H2,18,19,20) |
| InChIKey | PLLRJPWCJGQICP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|