C16H27IN4O2S2 — CID 111867815
1-(cyclopropylmethyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111867815) has the molecular formula C16H27IN4O2S2 and a molecular weight of 498.46 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclopropylmethyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111867815 |
| Molecular Formula | C16H27IN4O2S2 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCCC2)s1)NCC1CC1.I |
| InChI | InChI=1S/C16H26N4O2S2.HI/c1-17-16(18-11-13-5-6-13)19-12-14-7-8-15(23-14)24(21,22)20-9-3-2-4-10-20;/h7-8,13H,2-6,9-12H2,1H3,(H2,17,18,19);1H |
| InChIKey | YRIGRTNWZNNBMI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|