C17H26IN5O2S3 — CID 111522545
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111522545) has the molecular formula C17H26IN5O2S3 and a molecular weight of 555.53 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111522545 |
| Molecular Formula | C17H26IN5O2S3 |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCCC2)s1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C17H25N5O2S3.HI/c1-13-10-19-15(25-13)12-21-17(18-2)20-11-14-6-7-16(26-14)27(23,24)22-8-4-3-5-9-22;/h6-7,10H,3-5,8-9,11-12H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | LFTNNYKBYCZQDX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|