C19H27N5O2S2 — CID 111522172
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111522172) has the molecular formula C19H27N5O2S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111522172 |
| Molecular Formula | C19H27N5O2S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCc1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H27N5O2S2/c1-15-12-21-18(27-15)14-23-19(20-2)22-13-16-8-4-5-9-17(16)28(25,26)24-10-6-3-7-11-24/h4-5,8-9,12H,3,6-7,10-11,13-14H2,1-2H3,(H2,20,22,23) |
| InChIKey | IHZOWYURAYVIQK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|