C16H30IN5S — CID 111515544
2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111515544) has the molecular formula C16H30IN5S and a molecular weight of 451.42 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515544 |
| Molecular Formula | C16H30IN5S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCC(C)(C)N1CCCCC1.I |
| InChI | InChI=1S/C16H29N5S.HI/c1-13-10-18-14(22-13)11-19-15(17-4)20-12-16(2,3)21-8-6-5-7-9-21;/h10H,5-9,11-12H2,1-4H3,(H2,17,19,20);1H |
| InChIKey | QMHHKEKPWKVJLR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|