C13H26IN5S — CID 111522662
1-[2-(dimethylamino)-2-methylpropyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111522662) has the molecular formula C13H26IN5S and a molecular weight of 411.36 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-methylpropyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(dimethylamino)-2-methylpropyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111522662 |
| Molecular Formula | C13H26IN5S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[2-(dimethylamino)-2-methylpropyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ncc(C)s1)NCC(C)(C)N(C)C.I |
| InChI | InChI=1S/C13H25N5S.HI/c1-10-7-15-11(19-10)8-16-12(14-4)17-9-13(2,3)18(5)6;/h7H,8-9H2,1-6H3,(H2,14,16,17);1H |
| InChIKey | MKCCOJDBEFIKMW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|