C22H34IN5O3S — CID 111593198
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111593198) has the molecular formula C22H34IN5O3S and a molecular weight of 575.52 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111593198 |
| Molecular Formula | C22H34IN5O3S |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCc1ccccc1S(=O)(=O)N1CCCCC1.I |
| InChI | InChI=1S/C22H33N5O3S.HI/c1-22(2,3)19-15-24-20(30-19)16-26-21(23-4)25-14-17-10-6-7-11-18(17)31(28,29)27-12-8-5-9-13-27;/h6-7,10-11,15H,5,8-9,12-14,16H2,1-4H3,(H2,23,25,26);1H |
| InChIKey | RUWNHERRHUKNKR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|