C24H37N5O2 — CID 111592723
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylguanidine (PubChem CID 111592723) has the molecular formula C24H37N5O2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111592723 |
| Molecular Formula | C24H37N5O2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCc1ccccc1CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C24H37N5O2/c1-17-14-29(15-18(2)30-17)16-20-10-8-7-9-19(20)11-27-23(25-6)28-13-22-26-12-21(31-22)24(3,4)5/h7-10,12,17-18H,11,13-16H2,1-6H3,(H2,25,27,28) |
| InChIKey | MWNNUEWELYFNBQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|