C19H36IN5O — CID 111593963
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111593963) has the molecular formula C19H36IN5O and a molecular weight of 477.44 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111593963 |
| Molecular Formula | C19H36IN5O |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CC(C)CC(C)C1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C19H35N5O.HI/c1-14-9-15(2)13-24(12-14)8-7-21-18(20-6)23-11-17-22-10-16(25-17)19(3,4)5;/h10,14-15H,7-9,11-13H2,1-6H3,(H2,20,21,23);1H |
| InChIKey | RCENTAOFHPEMAR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|