C15H24N6O — CID 111594815
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine (PubChem CID 111594815) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111594815 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine |
| SMILES | C/N=C(\NCCn1cccn1)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C15H24N6O/c1-15(2,3)12-10-18-13(22-12)11-19-14(16-4)17-7-9-21-8-5-6-20-21/h5-6,8,10H,7,9,11H2,1-4H3,(H2,16,17,19) |
| InChIKey | LWBFYTPKPNZHAT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|