C17H28N6O — CID 111594530
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111594530) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111594530 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
| SMILES | C/N=C(/NCc1ncc(C(C)(C)C)o1)NCC(C)Cn1cccn1 |
| InChI | InChI=1S/C17H28N6O/c1-13(12-23-8-6-7-22-23)9-20-16(18-5)21-11-15-19-10-14(24-15)17(2,3)4/h6-8,10,13H,9,11-12H2,1-5H3,(H2,18,20,21) |
| InChIKey | KONPBMHJPKUPCU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|