C15H25IN6O — CID 109430732
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 109430732) has the molecular formula C15H25IN6O and a molecular weight of 432.31 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109430732 |
| Molecular Formula | C15H25IN6O |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(C)c(C)o1)NCC(C)Cn1cccn1.I |
| InChI | InChI=1S/C15H24N6O.HI/c1-11(10-21-7-5-6-19-21)8-17-15(16-4)18-9-14-20-12(2)13(3)22-14;/h5-7,11H,8-10H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | XWTWCOYJXFGPBG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|