C16H28IN7 — CID 111952594
2-methyl-1-(2-methyl-3-pyrazol-1-ylpropyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111952594) has the molecular formula C16H28IN7 and a molecular weight of 445.35 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-3-pyrazol-1-ylpropyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-3-pyrazol-1-ylpropyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111952594 |
| Molecular Formula | C16H28IN7 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-methyl-1-(2-methyl-3-pyrazol-1-ylpropyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1c(C)nn(C)c1C)NCC(C)Cn1cccn1.I |
| InChI | InChI=1S/C16H27N7.HI/c1-12(11-23-8-6-7-20-23)9-18-16(17-4)19-10-15-13(2)21-22(5)14(15)3;/h6-8,12H,9-11H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | VENZRAFWBITVNH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|