C14H24IN7 — CID 111950610
1-(2-imidazol-1-ylethyl)-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111950610) has the molecular formula C14H24IN7 and a molecular weight of 417.30 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-imidazol-1-ylethyl)-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111950610 |
| Molecular Formula | C14H24IN7 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCn1ccnc1)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C14H23N7.HI/c1-11-13(12(2)20(4)19-11)9-18-14(15-3)17-6-8-21-7-5-16-10-21;/h5,7,10H,6,8-9H2,1-4H3,(H2,15,17,18);1H |
| InChIKey | OKEHRRYMQCYKDT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|