C13H23IN8 — CID 111700594
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine;hydroiodide (PubChem CID 111700594) has the molecular formula C13H23IN8 and a molecular weight of 418.29 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111700594 |
| Molecular Formula | C13H23IN8 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N/C)NCCn1ccnc1.I |
| InChI | InChI=1S/C13H22N8.HI/c1-3-12-19-18-11-21(12)9-6-17-13(14-2)16-5-8-20-7-4-15-10-20;/h4,7,10-11H,3,5-6,8-9H2,1-2H3,(H2,14,16,17);1H |
| InChIKey | DMLZOYPIKORAKZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|