C13H22N8 — CID 111700595
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine (PubChem CID 111700595) has the molecular formula C13H22N8 and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111700595 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N/C)NCCn1ccnc1 |
| InChI | InChI=1S/C13H22N8/c1-3-12-19-18-11-21(12)9-6-17-13(14-2)16-5-8-20-7-4-15-10-20/h4,7,10-11H,3,5-6,8-9H2,1-2H3,(H2,14,16,17) |
| InChIKey | GDKZVOHNWQHSGF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|