C14H27N7O — CID 111699183
3-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide (PubChem CID 111699183) has the molecular formula C14H27N7O and a molecular weight of 309.42 g/mol. Its IUPAC name is 3-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide.
| Compound Name | 3-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 111699183 |
| Molecular Formula | C14H27N7O |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 3-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCN/C(=N\C)NCCn1cnnc1CC |
| InChI | InChI=1S/C14H27N7O/c1-4-7-16-13(22)6-8-17-14(15-3)18-9-10-21-11-19-20-12(21)5-2/h11H,4-10H2,1-3H3,(H,16,22)(H2,15,17,18) |
| InChIKey | HYIQSZBSGUUWIP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|