C14H26N6O2 — CID 111699797
ethyl 4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate (PubChem CID 111699797) has the molecular formula C14H26N6O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111699797 |
| Molecular Formula | C14H26N6O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethyl 4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)NCCn1cnnc1CC |
| InChI | InChI=1S/C14H26N6O2/c1-4-12-19-18-11-20(12)10-9-17-14(15-3)16-8-6-7-13(21)22-5-2/h11H,4-10H2,1-3H3,(H2,15,16,17) |
| InChIKey | DHOLKZRRYLPIKQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|